C23H25N3O — CID 50788828
(4-ethylpiperazin-1-yl)-(2-methyl-8-phenylquinolin-4-yl)methanone (PubChem CID 50788828) has the molecular formula C23H25N3O and a molecular weight of 359.47 g/mol. Its IUPAC name is (4-ethylpiperazin-1-yl)-(2-methyl-8-phenylquinolin-4-yl)methanone.
| Compound Name | (4-ethylpiperazin-1-yl)-(2-methyl-8-phenylquinolin-4-yl)methanone |
|---|---|
| PubChem CID | 50788828 |
| Molecular Formula | C23H25N3O |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | (4-ethylpiperazin-1-yl)-(2-methyl-8-phenylquinolin-4-yl)methanone |
| SMILES | CCN1CCN(C(=O)c2cc(C)nc3c(-c4ccccc4)cccc23)CC1 |
| InChI | InChI=1S/C23H25N3O/c1-3-25-12-14-26(15-13-25)23(27)21-16-17(2)24-22-19(10-7-11-20(21)22)18-8-5-4-6-9-18/h4-11,16H,3,12-15H2,1-2H3 |
| InChIKey | DXZIWKFEHQJZJW-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |