C24H27N3O3 — CID 35330467
[2-(2,5-dimethoxyphenyl)quinolin-4-yl]-(4-ethylpiperazin-1-yl)methanone (PubChem CID 35330467) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is [2-(2,5-dimethoxyphenyl)quinolin-4-yl]-(4-ethylpiperazin-1-yl)methanone.
| Compound Name | [2-(2,5-dimethoxyphenyl)quinolin-4-yl]-(4-ethylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 35330467 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | [2-(2,5-dimethoxyphenyl)quinolin-4-yl]-(4-ethylpiperazin-1-yl)methanone |
| SMILES | CCN1CCN(C(=O)c2cc(-c3cc(OC)ccc3OC)nc3ccccc23)CC1 |
| InChI | InChI=1S/C24H27N3O3/c1-4-26-11-13-27(14-12-26)24(28)19-16-22(25-21-8-6-5-7-18(19)21)20-15-17(29-2)9-10-23(20)30-3/h5-10,15-16H,4,11-14H2,1-3H3 |
| InChIKey | LAYZNZPGGQEYEZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |