C31H33N3O3 — CID 5093684
[2-(4-butoxyphenyl)quinolin-4-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone (PubChem CID 5093684) has the molecular formula C31H33N3O3 and a molecular weight of 495.62 g/mol. Its IUPAC name is [2-(4-butoxyphenyl)quinolin-4-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | [2-(4-butoxyphenyl)quinolin-4-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 5093684 |
| Molecular Formula | C31H33N3O3 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | [2-(4-butoxyphenyl)quinolin-4-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
| SMILES | CCCCOc1ccc(-c2cc(C(=O)N3CCN(c4ccc(OC)cc4)CC3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C31H33N3O3/c1-3-4-21-37-26-13-9-23(10-14-26)30-22-28(27-7-5-6-8-29(27)32-30)31(35)34-19-17-33(18-20-34)24-11-15-25(36-2)16-12-24/h5-16,22H,3-4,17-21H2,1-2H3 |
| InChIKey | ZTJTZVWAQRXHEL-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|