C28H24F3N3O2 — CID 1011234
[2-(4-methoxyphenyl)quinolin-4-yl]-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone (PubChem CID 1011234) has the molecular formula C28H24F3N3O2 and a molecular weight of 491.51 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)quinolin-4-yl]-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone.
| Compound Name | [2-(4-methoxyphenyl)quinolin-4-yl]-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 1011234 |
| Molecular Formula | C28H24F3N3O2 |
| Molecular Weight | 491.51 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | [2-(4-methoxyphenyl)quinolin-4-yl]-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
| SMILES | COc1ccc(-c2cc(C(=O)N3CCN(c4cccc(C(F)(F)F)c4)CC3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C28H24F3N3O2/c1-36-22-11-9-19(10-12-22)26-18-24(23-7-2-3-8-25(23)32-26)27(35)34-15-13-33(14-16-34)21-6-4-5-20(17-21)28(29,30)31/h2-12,17-18H,13-16H2,1H3 |
| InChIKey | PLZOTDCVMPZKCR-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.51 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |