C27H21F4N3O — CID 3557816
(6-fluoro-2-phenylquinolin-4-yl)-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone (PubChem CID 3557816) has the molecular formula C27H21F4N3O and a molecular weight of 479.48 g/mol. Its IUPAC name is (6-fluoro-2-phenylquinolin-4-yl)-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone.
| Compound Name | (6-fluoro-2-phenylquinolin-4-yl)-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 3557816 |
| Molecular Formula | C27H21F4N3O |
| Molecular Weight | 479.48 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | (6-fluoro-2-phenylquinolin-4-yl)-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1cc(-c2ccccc2)nc2ccc(F)cc12)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C27H21F4N3O/c28-20-9-10-24-22(16-20)23(17-25(32-24)18-5-2-1-3-6-18)26(35)34-13-11-33(12-14-34)21-8-4-7-19(15-21)27(29,30)31/h1-10,15-17H,11-14H2 |
| InChIKey | VMOBQPSGVSFYSG-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.48 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |