C29H26F3N3O2 — CID 4141764
[2-(3-ethoxyphenyl)quinolin-4-yl]-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone (PubChem CID 4141764) has the molecular formula C29H26F3N3O2 and a molecular weight of 505.54 g/mol. Its IUPAC name is [2-(3-ethoxyphenyl)quinolin-4-yl]-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone.
| Compound Name | [2-(3-ethoxyphenyl)quinolin-4-yl]-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 4141764 |
| Molecular Formula | C29H26F3N3O2 |
| Molecular Weight | 505.54 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | [2-(3-ethoxyphenyl)quinolin-4-yl]-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
| SMILES | CCOc1cccc(-c2cc(C(=O)N3CCN(c4cccc(C(F)(F)F)c4)CC3)c3ccccc3n2)c1 |
| InChI | InChI=1S/C29H26F3N3O2/c1-2-37-23-10-5-7-20(17-23)27-19-25(24-11-3-4-12-26(24)33-27)28(36)35-15-13-34(14-16-35)22-9-6-8-21(18-22)29(30,31)32/h3-12,17-19H,2,13-16H2,1H3 |
| InChIKey | NOPLAQZSAZVENW-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.54 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |