C27H25N3O2 — CID 4256561
[2-(3-methoxyphenyl)quinolin-4-yl]-(4-phenylpiperazin-1-yl)methanone (PubChem CID 4256561) has the molecular formula C27H25N3O2 and a molecular weight of 423.52 g/mol. Its IUPAC name is [2-(3-methoxyphenyl)quinolin-4-yl]-(4-phenylpiperazin-1-yl)methanone.
| Compound Name | [2-(3-methoxyphenyl)quinolin-4-yl]-(4-phenylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 4256561 |
| Molecular Formula | C27H25N3O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | [2-(3-methoxyphenyl)quinolin-4-yl]-(4-phenylpiperazin-1-yl)methanone |
| SMILES | COc1cccc(-c2cc(C(=O)N3CCN(c4ccccc4)CC3)c3ccccc3n2)c1 |
| InChI | InChI=1S/C27H25N3O2/c1-32-22-11-7-8-20(18-22)26-19-24(23-12-5-6-13-25(23)28-26)27(31)30-16-14-29(15-17-30)21-9-3-2-4-10-21/h2-13,18-19H,14-17H2,1H3 |
| InChIKey | ALKYLJNJNXOVEU-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |