C29H30N2O3 — CID 3274863
2-(4-butoxyphenyl)-N-[1-(4-methoxyphenyl)ethyl]quinoline-4-carboxamide (PubChem CID 3274863) has the molecular formula C29H30N2O3 and a molecular weight of 454.57 g/mol. Its IUPAC name is 2-(4-butoxyphenyl)-N-[1-(4-methoxyphenyl)ethyl]quinoline-4-carboxamide.
| Compound Name | 2-(4-butoxyphenyl)-N-[1-(4-methoxyphenyl)ethyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 3274863 |
| Molecular Formula | C29H30N2O3 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 2-(4-butoxyphenyl)-N-[1-(4-methoxyphenyl)ethyl]quinoline-4-carboxamide |
| SMILES | CCCCOc1ccc(-c2cc(C(=O)NC(C)c3ccc(OC)cc3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C29H30N2O3/c1-4-5-18-34-24-16-12-22(13-17-24)28-19-26(25-8-6-7-9-27(25)31-28)29(32)30-20(2)21-10-14-23(33-3)15-11-21/h6-17,19-20H,4-5,18H2,1-3H3,(H,30,32) |
| InChIKey | FARQAIPCSZQAGU-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|