C27H26N2O4 — CID 46098671
2-(4-ethoxyphenyl)-N-[2-(4-methoxyphenoxy)ethyl]quinoline-4-carboxamide (PubChem CID 46098671) has the molecular formula C27H26N2O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-N-[2-(4-methoxyphenoxy)ethyl]quinoline-4-carboxamide.
| Compound Name | 2-(4-ethoxyphenyl)-N-[2-(4-methoxyphenoxy)ethyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 46098671 |
| Molecular Formula | C27H26N2O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 2-(4-ethoxyphenyl)-N-[2-(4-methoxyphenoxy)ethyl]quinoline-4-carboxamide |
| SMILES | CCOc1ccc(-c2cc(C(=O)NCCOc3ccc(OC)cc3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C27H26N2O4/c1-3-32-21-10-8-19(9-11-21)26-18-24(23-6-4-5-7-25(23)29-26)27(30)28-16-17-33-22-14-12-20(31-2)13-15-22/h4-15,18H,3,16-17H2,1-2H3,(H,28,30) |
| InChIKey | WIGPSVPLBIBCNO-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|