C25H30N3O3+ — CID 5095371
2-(4-ethoxyphenyl)-N-(3-morpholin-4-ium-4-ylpropyl)quinoline-4-carboxamide (PubChem CID 5095371) has the molecular formula C25H30N3O3+ and a molecular weight of 420.53 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-N-(3-morpholin-4-ium-4-ylpropyl)quinoline-4-carboxamide.
| Compound Name | 2-(4-ethoxyphenyl)-N-(3-morpholin-4-ium-4-ylpropyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 5095371 |
| Molecular Formula | C25H30N3O3+ |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 2-(4-ethoxyphenyl)-N-(3-morpholin-4-ium-4-ylpropyl)quinoline-4-carboxamide |
| SMILES | CCOc1ccc(-c2cc(C(=O)NCCC[NH+]3CCOCC3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C25H29N3O3/c1-2-31-20-10-8-19(9-11-20)24-18-22(21-6-3-4-7-23(21)27-24)25(29)26-12-5-13-28-14-16-30-17-15-28/h3-4,6-11,18H,2,5,12-17H2,1H3,(H,26,29)/p+1 |
| InChIKey | NWXBKRJVRJWBRD-UHFFFAOYSA-O |
| XLogP | 2.34 |
| TPSA | 64.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|