C38H34N4O4 — CID 3631336
2-(4-methoxyphenyl)-N-[4-[[2-(4-methoxyphenyl)quinoline-4-carbonyl]amino]butyl]quinoline-4-carboxamide (PubChem CID 3631336) has the molecular formula C38H34N4O4 and a molecular weight of 610.71 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N-[4-[[2-(4-methoxyphenyl)quinoline-4-carbonyl]amino]butyl]quinoline-4-carboxamide.
| Compound Name | 2-(4-methoxyphenyl)-N-[4-[[2-(4-methoxyphenyl)quinoline-4-carbonyl]amino]butyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 3631336 |
| Molecular Formula | C38H34N4O4 |
| Molecular Weight | 610.71 g/mol |
| Exact Mass | 610.26 |
| IUPAC Name | 2-(4-methoxyphenyl)-N-[4-[[2-(4-methoxyphenyl)quinoline-4-carbonyl]amino]butyl]quinoline-4-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)NCCCCNC(=O)c3cc(-c4ccc(OC)cc4)nc4ccccc34)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C38H34N4O4/c1-45-27-17-13-25(14-18-27)35-23-31(29-9-3-5-11-33(29)41-35)37(43)39-21-7-8-22-40-38(44)32-24-36(26-15-19-28(46-2)20-16-26)42-34-12-6-4-10-30(32)34/h3-6,9-20,23-24H,7-8,21-22H2,1-2H3,(H,39,43)(H,40,44) |
| InChIKey | IMUHFJRVFFIKQE-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.71 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|