C23H26N4O2S — CID 9220474
1-[[2-(4-methoxyphenyl)quinoline-4-carbonyl]amino]-3-pentylthiourea (PubChem CID 9220474) has the molecular formula C23H26N4O2S and a molecular weight of 422.55 g/mol. Its IUPAC name is 1-[[2-(4-methoxyphenyl)quinoline-4-carbonyl]amino]-3-pentylthiourea.
| Compound Name | 1-[[2-(4-methoxyphenyl)quinoline-4-carbonyl]amino]-3-pentylthiourea |
|---|---|
| PubChem CID | 9220474 |
| Molecular Formula | C23H26N4O2S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 1-[[2-(4-methoxyphenyl)quinoline-4-carbonyl]amino]-3-pentylthiourea |
| SMILES | CCCCCNC(=S)NNC(=O)c1cc(-c2ccc(OC)cc2)nc2ccccc12 |
| InChI | InChI=1S/C23H26N4O2S/c1-3-4-7-14-24-23(30)27-26-22(28)19-15-21(16-10-12-17(29-2)13-11-16)25-20-9-6-5-8-18(19)20/h5-6,8-13,15H,3-4,7,14H2,1-2H3,(H,26,28)(H2,24,27,30) |
| InChIKey | BQXRHPIPYSJEJX-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|