C21H22FN5OS — CID 8628003
1-[2-(dimethylamino)ethyl]-3-[[2-(4-fluorophenyl)quinoline-4-carbonyl]amino]thiourea (PubChem CID 8628003) has the molecular formula C21H22FN5OS and a molecular weight of 411.51 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethyl]-3-[[2-(4-fluorophenyl)quinoline-4-carbonyl]amino]thiourea.
| Compound Name | 1-[2-(dimethylamino)ethyl]-3-[[2-(4-fluorophenyl)quinoline-4-carbonyl]amino]thiourea |
|---|---|
| PubChem CID | 8628003 |
| Molecular Formula | C21H22FN5OS |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 1-[2-(dimethylamino)ethyl]-3-[[2-(4-fluorophenyl)quinoline-4-carbonyl]amino]thiourea |
| SMILES | CN(C)CCNC(=S)NNC(=O)c1cc(-c2ccc(F)cc2)nc2ccccc12 |
| InChI | InChI=1S/C21H22FN5OS/c1-27(2)12-11-23-21(29)26-25-20(28)17-13-19(14-7-9-15(22)10-8-14)24-18-6-4-3-5-16(17)18/h3-10,13H,11-12H2,1-2H3,(H,25,28)(H2,23,26,29) |
| InChIKey | WPQKYSIXPBEJCB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|