C20H19ClN4OS — CID 7940652
1-[[2-(4-chlorophenyl)quinoline-4-carbonyl]amino]-3-propan-2-ylthiourea (PubChem CID 7940652) has the molecular formula C20H19ClN4OS and a molecular weight of 398.92 g/mol. Its IUPAC name is 1-[[2-(4-chlorophenyl)quinoline-4-carbonyl]amino]-3-propan-2-ylthiourea.
| Compound Name | 1-[[2-(4-chlorophenyl)quinoline-4-carbonyl]amino]-3-propan-2-ylthiourea |
|---|---|
| PubChem CID | 7940652 |
| Molecular Formula | C20H19ClN4OS |
| Molecular Weight | 398.92 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 1-[[2-(4-chlorophenyl)quinoline-4-carbonyl]amino]-3-propan-2-ylthiourea |
| SMILES | CC(C)NC(=S)NNC(=O)c1cc(-c2ccc(Cl)cc2)nc2ccccc12 |
| InChI | InChI=1S/C20H19ClN4OS/c1-12(2)22-20(27)25-24-19(26)16-11-18(13-7-9-14(21)10-8-13)23-17-6-4-3-5-15(16)17/h3-12H,1-2H3,(H,24,26)(H2,22,25,27) |
| InChIKey | NCDAJRSHSGVNMY-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.92 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|