C26H22ClN3O5 — CID 24540316
2-(4-chlorophenyl)-N'-(3,4,5-trimethoxybenzoyl)quinoline-4-carbohydrazide (PubChem CID 24540316) has the molecular formula C26H22ClN3O5 and a molecular weight of 491.93 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N'-(3,4,5-trimethoxybenzoyl)quinoline-4-carbohydrazide.
| Compound Name | 2-(4-chlorophenyl)-N'-(3,4,5-trimethoxybenzoyl)quinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 24540316 |
| Molecular Formula | C26H22ClN3O5 |
| Molecular Weight | 491.93 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | 2-(4-chlorophenyl)-N'-(3,4,5-trimethoxybenzoyl)quinoline-4-carbohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)c2cc(-c3ccc(Cl)cc3)nc3ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C26H22ClN3O5/c1-33-22-12-16(13-23(34-2)24(22)35-3)25(31)29-30-26(32)19-14-21(15-8-10-17(27)11-9-15)28-20-7-5-4-6-18(19)20/h4-14H,1-3H3,(H,29,31)(H,30,32) |
| InChIKey | FTXUAAQWBLSCGX-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.93 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|