C24H19N3O3 — CID 6734416
N'-(2-methoxybenzoyl)-2-phenylquinoline-4-carbohydrazide (PubChem CID 6734416) has the molecular formula C24H19N3O3 and a molecular weight of 397.43 g/mol. Its IUPAC name is N'-(2-methoxybenzoyl)-2-phenylquinoline-4-carbohydrazide.
| Compound Name | N'-(2-methoxybenzoyl)-2-phenylquinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 6734416 |
| Molecular Formula | C24H19N3O3 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | N'-(2-methoxybenzoyl)-2-phenylquinoline-4-carbohydrazide |
| SMILES | COc1ccccc1C(=O)NNC(=O)c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C24H19N3O3/c1-30-22-14-8-6-12-18(22)23(28)26-27-24(29)19-15-21(16-9-3-2-4-10-16)25-20-13-7-5-11-17(19)20/h2-15H,1H3,(H,26,28)(H,27,29) |
| InChIKey | DHZURBSNXVXEBM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|