C26H19FN2O5 — CID 35832298
[2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 2-(4-fluorophenyl)quinoline-4-carboxylate (PubChem CID 35832298) has the molecular formula C26H19FN2O5 and a molecular weight of 458.45 g/mol. Its IUPAC name is [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 2-(4-fluorophenyl)quinoline-4-carboxylate.
| Compound Name | [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 2-(4-fluorophenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 35832298 |
| Molecular Formula | C26H19FN2O5 |
| Molecular Weight | 458.45 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 2-(4-fluorophenyl)quinoline-4-carboxylate |
| SMILES | COc1ccccc1C(=O)NC(=O)COC(=O)c1cc(-c2ccc(F)cc2)nc2ccccc12 |
| InChI | InChI=1S/C26H19FN2O5/c1-33-23-9-5-3-7-19(23)25(31)29-24(30)15-34-26(32)20-14-22(16-10-12-17(27)13-11-16)28-21-8-4-2-6-18(20)21/h2-14H,15H2,1H3,(H,29,30,31) |
| InChIKey | LPNHFDPXVUDFLS-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |