C26H20FN3O5 — CID 16958742
[2-(4,5-dimethyl-2-nitroanilino)-2-oxoethyl] 2-(4-fluorophenyl)quinoline-4-carboxylate (PubChem CID 16958742) has the molecular formula C26H20FN3O5 and a molecular weight of 473.46 g/mol. Its IUPAC name is [2-(4,5-dimethyl-2-nitroanilino)-2-oxoethyl] 2-(4-fluorophenyl)quinoline-4-carboxylate.
| Compound Name | [2-(4,5-dimethyl-2-nitroanilino)-2-oxoethyl] 2-(4-fluorophenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 16958742 |
| Molecular Formula | C26H20FN3O5 |
| Molecular Weight | 473.46 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | [2-(4,5-dimethyl-2-nitroanilino)-2-oxoethyl] 2-(4-fluorophenyl)quinoline-4-carboxylate |
| SMILES | Cc1cc(NC(=O)COC(=O)c2cc(-c3ccc(F)cc3)nc3ccccc23)c([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C26H20FN3O5/c1-15-11-23(24(30(33)34)12-16(15)2)29-25(31)14-35-26(32)20-13-22(17-7-9-18(27)10-8-17)28-21-6-4-3-5-19(20)21/h3-13H,14H2,1-2H3,(H,29,31) |
| InChIKey | SIEBDWURZPOUAY-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.46 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|