C29H26FN3O4 — CID 29405110
[2-[4-(diethylcarbamoyl)anilino]-2-oxoethyl] 2-(4-fluorophenyl)quinoline-4-carboxylate (PubChem CID 29405110) has the molecular formula C29H26FN3O4 and a molecular weight of 499.54 g/mol. Its IUPAC name is [2-[4-(diethylcarbamoyl)anilino]-2-oxoethyl] 2-(4-fluorophenyl)quinoline-4-carboxylate.
| Compound Name | [2-[4-(diethylcarbamoyl)anilino]-2-oxoethyl] 2-(4-fluorophenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 29405110 |
| Molecular Formula | C29H26FN3O4 |
| Molecular Weight | 499.54 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | [2-[4-(diethylcarbamoyl)anilino]-2-oxoethyl] 2-(4-fluorophenyl)quinoline-4-carboxylate |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)COC(=O)c2cc(-c3ccc(F)cc3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C29H26FN3O4/c1-3-33(4-2)28(35)20-11-15-22(16-12-20)31-27(34)18-37-29(36)24-17-26(19-9-13-21(30)14-10-19)32-25-8-6-5-7-23(24)25/h5-17H,3-4,18H2,1-2H3,(H,31,34) |
| InChIKey | BDTWTGCJADGWIR-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.54 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |