C25H19FN2O3 — CID 7825012
[2-(3-fluoroanilino)-2-oxoethyl] 2-(4-methylphenyl)quinoline-4-carboxylate (PubChem CID 7825012) has the molecular formula C25H19FN2O3 and a molecular weight of 414.44 g/mol. Its IUPAC name is [2-(3-fluoroanilino)-2-oxoethyl] 2-(4-methylphenyl)quinoline-4-carboxylate.
| Compound Name | [2-(3-fluoroanilino)-2-oxoethyl] 2-(4-methylphenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 7825012 |
| Molecular Formula | C25H19FN2O3 |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | [2-(3-fluoroanilino)-2-oxoethyl] 2-(4-methylphenyl)quinoline-4-carboxylate |
| SMILES | Cc1ccc(-c2cc(C(=O)OCC(=O)Nc3cccc(F)c3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C25H19FN2O3/c1-16-9-11-17(12-10-16)23-14-21(20-7-2-3-8-22(20)28-23)25(30)31-15-24(29)27-19-6-4-5-18(26)13-19/h2-14H,15H2,1H3,(H,27,29) |
| InChIKey | SRDRNGVUYPYRAH-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |