C26H23N3O5S — CID 16539935
[2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-phenylquinoline-4-carboxylate (PubChem CID 16539935) has the molecular formula C26H23N3O5S and a molecular weight of 489.55 g/mol. Its IUPAC name is [2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-phenylquinoline-4-carboxylate.
| Compound Name | [2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-phenylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 16539935 |
| Molecular Formula | C26H23N3O5S |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | [2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-phenylquinoline-4-carboxylate |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC(=O)COC(=O)c2cc(-c3ccccc3)nc3ccccc23)c1 |
| InChI | InChI=1S/C26H23N3O5S/c1-29(2)35(32,33)20-12-8-11-19(15-20)27-25(30)17-34-26(31)22-16-24(18-9-4-3-5-10-18)28-23-14-7-6-13-21(22)23/h3-16H,17H2,1-2H3,(H,27,30) |
| InChIKey | CDJRJVBQBURGNN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |