C17H15ClF2N2O5S — CID 16528295
[2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate (PubChem CID 16528295) has the molecular formula C17H15ClF2N2O5S and a molecular weight of 432.83 g/mol. Its IUPAC name is [2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate.
| Compound Name | [2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 16528295 |
| Molecular Formula | C17H15ClF2N2O5S |
| Molecular Weight | 432.83 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | [2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC(=O)COC(=O)c2cc(F)c(F)cc2Cl)c1 |
| InChI | InChI=1S/C17H15ClF2N2O5S/c1-22(2)28(25,26)11-5-3-4-10(6-11)21-16(23)9-27-17(24)12-7-14(19)15(20)8-13(12)18/h3-8H,9H2,1-2H3,(H,21,23) |
| InChIKey | LAUZUTIKRRPOIE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.83 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|