C17H15Cl3N2O5S — CID 2524372
[2-(2,4-dichloroanilino)-2-oxoethyl] 2-chloro-5-(dimethylsulfamoyl)benzoate (PubChem CID 2524372) has the molecular formula C17H15Cl3N2O5S and a molecular weight of 465.74 g/mol. Its IUPAC name is [2-(2,4-dichloroanilino)-2-oxoethyl] 2-chloro-5-(dimethylsulfamoyl)benzoate.
| Compound Name | [2-(2,4-dichloroanilino)-2-oxoethyl] 2-chloro-5-(dimethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2524372 |
| Molecular Formula | C17H15Cl3N2O5S |
| Molecular Weight | 465.74 g/mol |
| Exact Mass | 463.98 |
| IUPAC Name | [2-(2,4-dichloroanilino)-2-oxoethyl] 2-chloro-5-(dimethylsulfamoyl)benzoate |
| SMILES | CN(C)S(=O)(=O)c1ccc(Cl)c(C(=O)OCC(=O)Nc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C17H15Cl3N2O5S/c1-22(2)28(25,26)11-4-5-13(19)12(8-11)17(24)27-9-16(23)21-15-6-3-10(18)7-14(15)20/h3-8H,9H2,1-2H3,(H,21,23) |
| InChIKey | AZMMEBRSAONJDM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.74 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |