C18H17ClN2O6S — CID 2523778
(2-benzamido-2-oxoethyl) 2-chloro-5-(dimethylsulfamoyl)benzoate (PubChem CID 2523778) has the molecular formula C18H17ClN2O6S and a molecular weight of 424.86 g/mol. Its IUPAC name is (2-benzamido-2-oxoethyl) 2-chloro-5-(dimethylsulfamoyl)benzoate.
| Compound Name | (2-benzamido-2-oxoethyl) 2-chloro-5-(dimethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2523778 |
| Molecular Formula | C18H17ClN2O6S |
| Molecular Weight | 424.86 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | (2-benzamido-2-oxoethyl) 2-chloro-5-(dimethylsulfamoyl)benzoate |
| SMILES | CN(C)S(=O)(=O)c1ccc(Cl)c(C(=O)OCC(=O)NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C18H17ClN2O6S/c1-21(2)28(25,26)13-8-9-15(19)14(10-13)18(24)27-11-16(22)20-17(23)12-6-4-3-5-7-12/h3-10H,11H2,1-2H3,(H,20,22,23) |
| InChIKey | UEHUWGYOVYWUKY-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.86 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |