C16H15Cl2N3O5S — CID 2648905
[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-chloro-5-(dimethylsulfamoyl)benzoate (PubChem CID 2648905) has the molecular formula C16H15Cl2N3O5S and a molecular weight of 432.29 g/mol. Its IUPAC name is [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-chloro-5-(dimethylsulfamoyl)benzoate.
| Compound Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-chloro-5-(dimethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2648905 |
| Molecular Formula | C16H15Cl2N3O5S |
| Molecular Weight | 432.29 g/mol |
| Exact Mass | 431.01 |
| IUPAC Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-chloro-5-(dimethylsulfamoyl)benzoate |
| SMILES | CN(C)S(=O)(=O)c1ccc(Cl)c(C(=O)OCC(=O)Nc2ccc(Cl)cn2)c1 |
| InChI | InChI=1S/C16H15Cl2N3O5S/c1-21(2)27(24,25)11-4-5-13(18)12(7-11)16(23)26-9-15(22)20-14-6-3-10(17)8-19-14/h3-8H,9H2,1-2H3,(H,19,20,22) |
| InChIKey | WPCOTLFYJAJYTL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.29 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |