C16H23ClN2O5S — CID 18075378
[2-oxo-2-(pentan-2-ylamino)ethyl] 2-chloro-5-(dimethylsulfamoyl)benzoate (PubChem CID 18075378) has the molecular formula C16H23ClN2O5S and a molecular weight of 390.89 g/mol. Its IUPAC name is [2-oxo-2-(pentan-2-ylamino)ethyl] 2-chloro-5-(dimethylsulfamoyl)benzoate.
| Compound Name | [2-oxo-2-(pentan-2-ylamino)ethyl] 2-chloro-5-(dimethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 18075378 |
| Molecular Formula | C16H23ClN2O5S |
| Molecular Weight | 390.89 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | [2-oxo-2-(pentan-2-ylamino)ethyl] 2-chloro-5-(dimethylsulfamoyl)benzoate |
| SMILES | CCCC(C)NC(=O)COC(=O)c1cc(S(=O)(=O)N(C)C)ccc1Cl |
| InChI | InChI=1S/C16H23ClN2O5S/c1-5-6-11(2)18-15(20)10-24-16(21)13-9-12(7-8-14(13)17)25(22,23)19(3)4/h7-9,11H,5-6,10H2,1-4H3,(H,18,20) |
| InChIKey | KPSJNUMITWFSJZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.89 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |