C21H25ClN2O5S — CID 2510286
[2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl] 2-chloro-5-(diethylsulfamoyl)benzoate (PubChem CID 2510286) has the molecular formula C21H25ClN2O5S and a molecular weight of 452.96 g/mol. Its IUPAC name is [2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl] 2-chloro-5-(diethylsulfamoyl)benzoate.
| Compound Name | [2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl] 2-chloro-5-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2510286 |
| Molecular Formula | C21H25ClN2O5S |
| Molecular Weight | 452.96 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | [2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl] 2-chloro-5-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Cl)c(C(=O)OCC(=O)N[C@@H](C)c2ccccc2)c1 |
| InChI | InChI=1S/C21H25ClN2O5S/c1-4-24(5-2)30(27,28)17-11-12-19(22)18(13-17)21(26)29-14-20(25)23-15(3)16-9-7-6-8-10-16/h6-13,15H,4-5,14H2,1-3H3,(H,23,25)/t15-/m0/s1 |
| InChIKey | MPTFARUQOZOLFV-HNNXBMFYSA-N |
| XLogP | 3.40 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.96 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |