About 1-phenylethyl 2-chloro-5-(diethylsulfamoyl)benzoate
1-phenylethyl 2-chloro-5-(diethylsulfamoyl)benzoate (PubChem CID 16521782) has the molecular formula C19H22ClNO4S
and a molecular weight of 395.91 g/mol. Its IUPAC name is 1-phenylethyl 2-chloro-5-(diethylsulfamoyl)benzoate.
Molecular Properties
| Compound Name | 1-phenylethyl 2-chloro-5-(diethylsulfamoyl)benzoate |
| PubChem CID | 16521782 |
| Molecular Formula | C19H22ClNO4S |
| Molecular Weight | 395.91 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 1-phenylethyl 2-chloro-5-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Cl)c(C(=O)OC(C)c2ccccc2)c1 |
| InChI | InChI=1S/C19H22ClNO4S/c1-4-21(5-2)26(23,24)16-11-12-18(20)17(13-16)19(22)25-14(3)15-9-7-6-8-10-15/h6-14H,4-5H2,1-3H3 |
| InChIKey | FAAMBODRPBLGPO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.91 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-phenylethyl 2-chloro-5-(diethylsulfamoyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylethyl 2-chloro-5-(diethylsulfamoyl)benzoate?
The IUPAC name of 1-phenylethyl 2-chloro-5-(diethylsulfamoyl)benzoate (CID 16521782) is 1-phenylethyl 2-chloro-5-(diethylsulfamoyl)benzoate.
What is the SMILES notation for 1-phenylethyl 2-chloro-5-(diethylsulfamoyl)benzoate?
The canonical SMILES for 1-phenylethyl 2-chloro-5-(diethylsulfamoyl)benzoate is CCN(CC)S(=O)(=O)c1ccc(Cl)c(C(=O)OC(C)c2ccccc2)c1.
What is the InChIKey of 1-phenylethyl 2-chloro-5-(diethylsulfamoyl)benzoate?
The InChIKey is FAAMBODRPBLGPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22ClNO4S/c1-4-21(5-2)26(23,24)16-11-12-18(20)17(13-16)19(22)25-14(3)15-9-7-6-8-10-15/h6-14H,4-5H2,1-3H3.
What are the key properties of 1-phenylethyl 2-chloro-5-(diethylsulfamoyl)benzoate?
1-phenylethyl 2-chloro-5-(diethylsulfamoyl)benzoate has a molecular weight of 395.91 g/mol, XLogP of 4.29, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylethyl 2-chloro-5-(diethylsulfamoyl)benzoate is sourced from PubChem (CID 16521782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).