C15H20ClN3O6S — CID 4542283
[1-(carbamoylamino)-1-oxopropan-2-yl] 2-chloro-5-(diethylsulfamoyl)benzoate (PubChem CID 4542283) has the molecular formula C15H20ClN3O6S and a molecular weight of 405.86 g/mol. Its IUPAC name is [1-(carbamoylamino)-1-oxopropan-2-yl] 2-chloro-5-(diethylsulfamoyl)benzoate.
| Compound Name | [1-(carbamoylamino)-1-oxopropan-2-yl] 2-chloro-5-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 4542283 |
| Molecular Formula | C15H20ClN3O6S |
| Molecular Weight | 405.86 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | [1-(carbamoylamino)-1-oxopropan-2-yl] 2-chloro-5-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Cl)c(C(=O)OC(C)C(=O)NC(N)=O)c1 |
| InChI | InChI=1S/C15H20ClN3O6S/c1-4-19(5-2)26(23,24)10-6-7-12(16)11(8-10)14(21)25-9(3)13(20)18-15(17)22/h6-9H,4-5H2,1-3H3,(H3,17,18,20,22) |
| InChIKey | JFEQNZJELLQIQF-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.86 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |