C18H18ClN3O6S — CID 2577281
[(2R)-1-(carbamoylamino)-1-oxopropan-2-yl] 2-chloro-5-[methyl(phenyl)sulfamoyl]benzoate (PubChem CID 2577281) has the molecular formula C18H18ClN3O6S and a molecular weight of 439.88 g/mol. Its IUPAC name is [(2R)-1-(carbamoylamino)-1-oxopropan-2-yl] 2-chloro-5-[methyl(phenyl)sulfamoyl]benzoate.
| Compound Name | [(2R)-1-(carbamoylamino)-1-oxopropan-2-yl] 2-chloro-5-[methyl(phenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 2577281 |
| Molecular Formula | C18H18ClN3O6S |
| Molecular Weight | 439.88 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | [(2R)-1-(carbamoylamino)-1-oxopropan-2-yl] 2-chloro-5-[methyl(phenyl)sulfamoyl]benzoate |
| SMILES | C[C@@H](OC(=O)c1cc(S(=O)(=O)N(C)c2ccccc2)ccc1Cl)C(=O)NC(N)=O |
| InChI | InChI=1S/C18H18ClN3O6S/c1-11(16(23)21-18(20)25)28-17(24)14-10-13(8-9-15(14)19)29(26,27)22(2)12-6-4-3-5-7-12/h3-11H,1-2H3,(H3,20,21,23,25)/t11-/m1/s1 |
| InChIKey | BATGMZHZAVJIFC-LLVKDONJSA-N |
| XLogP | 1.91 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.88 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |