C21H24ClN3O6S — CID 4686957
[1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 5-[benzyl(methyl)sulfamoyl]-2-chlorobenzoate (PubChem CID 4686957) has the molecular formula C21H24ClN3O6S and a molecular weight of 481.96 g/mol. Its IUPAC name is [1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 5-[benzyl(methyl)sulfamoyl]-2-chlorobenzoate.
| Compound Name | [1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 5-[benzyl(methyl)sulfamoyl]-2-chlorobenzoate |
|---|---|
| PubChem CID | 4686957 |
| Molecular Formula | C21H24ClN3O6S |
| Molecular Weight | 481.96 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | [1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 5-[benzyl(methyl)sulfamoyl]-2-chlorobenzoate |
| SMILES | CCNC(=O)NC(=O)C(C)OC(=O)c1cc(S(=O)(=O)N(C)Cc2ccccc2)ccc1Cl |
| InChI | InChI=1S/C21H24ClN3O6S/c1-4-23-21(28)24-19(26)14(2)31-20(27)17-12-16(10-11-18(17)22)32(29,30)25(3)13-15-8-6-5-7-9-15/h5-12,14H,4,13H2,1-3H3,(H2,23,24,26,28) |
| InChIKey | HFMWNHMAQPDHPK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.96 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |