C22H26FN3O6S — CID 55423845
[1-(benzylcarbamoylamino)-1-oxopropan-2-yl] 5-(diethylsulfamoyl)-2-fluorobenzoate (PubChem CID 55423845) has the molecular formula C22H26FN3O6S and a molecular weight of 479.53 g/mol. Its IUPAC name is [1-(benzylcarbamoylamino)-1-oxopropan-2-yl] 5-(diethylsulfamoyl)-2-fluorobenzoate.
| Compound Name | [1-(benzylcarbamoylamino)-1-oxopropan-2-yl] 5-(diethylsulfamoyl)-2-fluorobenzoate |
|---|---|
| PubChem CID | 55423845 |
| Molecular Formula | C22H26FN3O6S |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | [1-(benzylcarbamoylamino)-1-oxopropan-2-yl] 5-(diethylsulfamoyl)-2-fluorobenzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(F)c(C(=O)OC(C)C(=O)NC(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C22H26FN3O6S/c1-4-26(5-2)33(30,31)17-11-12-19(23)18(13-17)21(28)32-15(3)20(27)25-22(29)24-14-16-9-7-6-8-10-16/h6-13,15H,4-5,14H2,1-3H3,(H2,24,25,27,29) |
| InChIKey | ZCEYPOTXGGGEPP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |