C19H27FN2O5S — CID 7803520
[(2S)-1-(cyclopentylamino)-1-oxopropan-2-yl] 5-(diethylsulfamoyl)-2-fluorobenzoate (PubChem CID 7803520) has the molecular formula C19H27FN2O5S and a molecular weight of 414.50 g/mol. Its IUPAC name is [(2S)-1-(cyclopentylamino)-1-oxopropan-2-yl] 5-(diethylsulfamoyl)-2-fluorobenzoate.
| Compound Name | [(2S)-1-(cyclopentylamino)-1-oxopropan-2-yl] 5-(diethylsulfamoyl)-2-fluorobenzoate |
|---|---|
| PubChem CID | 7803520 |
| Molecular Formula | C19H27FN2O5S |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | [(2S)-1-(cyclopentylamino)-1-oxopropan-2-yl] 5-(diethylsulfamoyl)-2-fluorobenzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(F)c(C(=O)O[C@@H](C)C(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C19H27FN2O5S/c1-4-22(5-2)28(25,26)15-10-11-17(20)16(12-15)19(24)27-13(3)18(23)21-14-8-6-7-9-14/h10-14H,4-9H2,1-3H3,(H,21,23)/t13-/m0/s1 |
| InChIKey | SKADTZHZBVVDQK-ZDUSSCGKSA-N |
| XLogP | 2.46 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |