C16H19ClFNO3 — CID 8620496
[(2S)-1-(cyclohexylamino)-1-oxopropan-2-yl] 5-chloro-2-fluorobenzoate (PubChem CID 8620496) has the molecular formula C16H19ClFNO3 and a molecular weight of 327.78 g/mol. Its IUPAC name is [(2S)-1-(cyclohexylamino)-1-oxopropan-2-yl] 5-chloro-2-fluorobenzoate.
| Compound Name | [(2S)-1-(cyclohexylamino)-1-oxopropan-2-yl] 5-chloro-2-fluorobenzoate |
|---|---|
| PubChem CID | 8620496 |
| Molecular Formula | C16H19ClFNO3 |
| Molecular Weight | 327.78 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | [(2S)-1-(cyclohexylamino)-1-oxopropan-2-yl] 5-chloro-2-fluorobenzoate |
| SMILES | C[C@H](OC(=O)c1cc(Cl)ccc1F)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C16H19ClFNO3/c1-10(15(20)19-12-5-3-2-4-6-12)22-16(21)13-9-11(17)7-8-14(13)18/h7-10,12H,2-6H2,1H3,(H,19,20)/t10-/m0/s1 |
| InChIKey | LOWDMLKDRZQQDM-JTQLQIEISA-N |
| XLogP | 3.47 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.78 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |