C15H18ClNO3 — CID 7838656
[(2S)-1-(cyclopentylamino)-1-oxopropan-2-yl] 3-chlorobenzoate (PubChem CID 7838656) has the molecular formula C15H18ClNO3 and a molecular weight of 295.77 g/mol. Its IUPAC name is [(2S)-1-(cyclopentylamino)-1-oxopropan-2-yl] 3-chlorobenzoate.
| Compound Name | [(2S)-1-(cyclopentylamino)-1-oxopropan-2-yl] 3-chlorobenzoate |
|---|---|
| PubChem CID | 7838656 |
| Molecular Formula | C15H18ClNO3 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | [(2S)-1-(cyclopentylamino)-1-oxopropan-2-yl] 3-chlorobenzoate |
| SMILES | C[C@H](OC(=O)c1cccc(Cl)c1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C15H18ClNO3/c1-10(14(18)17-13-7-2-3-8-13)20-15(19)11-5-4-6-12(16)9-11/h4-6,9-10,13H,2-3,7-8H2,1H3,(H,17,18)/t10-/m0/s1 |
| InChIKey | BWSFUEJLBQRRMY-JTQLQIEISA-N |
| XLogP | 2.94 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |