C14H17NO3 — CID 7382068
[(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 3-methylbenzoate (PubChem CID 7382068) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 3-methylbenzoate.
| Compound Name | [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 3-methylbenzoate |
|---|---|
| PubChem CID | 7382068 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)O[C@@H](C)C(=O)NC2CC2)c1 |
| InChI | InChI=1S/C14H17NO3/c1-9-4-3-5-11(8-9)14(17)18-10(2)13(16)15-12-6-7-12/h3-5,8,10,12H,6-7H2,1-2H3,(H,15,16)/t10-/m0/s1 |
| InChIKey | YQHBMCYZNQAPPO-JTQLQIEISA-N |
| XLogP | 1.82 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |