C14H16N2O5 — CID 8630084
[(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 3-methyl-4-nitrobenzoate (PubChem CID 8630084) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 3-methyl-4-nitrobenzoate.
| Compound Name | [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 3-methyl-4-nitrobenzoate |
|---|---|
| PubChem CID | 8630084 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 3-methyl-4-nitrobenzoate |
| SMILES | Cc1cc(C(=O)O[C@@H](C)C(=O)NC2CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H16N2O5/c1-8-7-10(3-6-12(8)16(19)20)14(18)21-9(2)13(17)15-11-4-5-11/h3,6-7,9,11H,4-5H2,1-2H3,(H,15,17)/t9-/m0/s1 |
| InChIKey | RONSOBGBLZSWGB-VIFPVBQESA-N |
| XLogP | 1.73 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|