C17H22N2O4 — CID 2638280
[(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] 3-acetamidobenzoate (PubChem CID 2638280) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is [(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] 3-acetamidobenzoate.
| Compound Name | [(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] 3-acetamidobenzoate |
|---|---|
| PubChem CID | 2638280 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | [(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] 3-acetamidobenzoate |
| SMILES | CC(=O)Nc1cccc(C(=O)O[C@H](C)C(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C17H22N2O4/c1-11(16(21)19-14-7-3-4-8-14)23-17(22)13-6-5-9-15(10-13)18-12(2)20/h5-6,9-11,14H,3-4,7-8H2,1-2H3,(H,18,20)(H,19,21)/t11-/m1/s1 |
| InChIKey | TZAQIUNGQLGDAR-LLVKDONJSA-N |
| XLogP | 2.25 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |