C15H20N2O5S — CID 7666884
[(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 3-(dimethylsulfamoyl)benzoate (PubChem CID 7666884) has the molecular formula C15H20N2O5S and a molecular weight of 340.40 g/mol. Its IUPAC name is [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 3-(dimethylsulfamoyl)benzoate.
| Compound Name | [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 3-(dimethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 7666884 |
| Molecular Formula | C15H20N2O5S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 3-(dimethylsulfamoyl)benzoate |
| SMILES | C[C@H](OC(=O)c1cccc(S(=O)(=O)N(C)C)c1)C(=O)NC1CC1 |
| InChI | InChI=1S/C15H20N2O5S/c1-10(14(18)16-12-7-8-12)22-15(19)11-5-4-6-13(9-11)23(20,21)17(2)3/h4-6,9-10,12H,7-8H2,1-3H3,(H,16,18)/t10-/m0/s1 |
| InChIKey | NFKDQJRJFVGYGM-JTQLQIEISA-N |
| XLogP | 0.76 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |