C18H25NO3 — CID 3637168
[1-(cyclopentylamino)-1-oxopropan-2-yl] 4-propan-2-ylbenzoate (PubChem CID 3637168) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is [1-(cyclopentylamino)-1-oxopropan-2-yl] 4-propan-2-ylbenzoate.
| Compound Name | [1-(cyclopentylamino)-1-oxopropan-2-yl] 4-propan-2-ylbenzoate |
|---|---|
| PubChem CID | 3637168 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | [1-(cyclopentylamino)-1-oxopropan-2-yl] 4-propan-2-ylbenzoate |
| SMILES | CC(OC(=O)c1ccc(C(C)C)cc1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C18H25NO3/c1-12(2)14-8-10-15(11-9-14)18(21)22-13(3)17(20)19-16-6-4-5-7-16/h8-13,16H,4-7H2,1-3H3,(H,19,20) |
| InChIKey | UBCPQLQEKBOFKC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |