C18H25NO4 — CID 7193376
[(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] 4-propan-2-yloxybenzoate (PubChem CID 7193376) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is [(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] 4-propan-2-yloxybenzoate.
| Compound Name | [(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] 4-propan-2-yloxybenzoate |
|---|---|
| PubChem CID | 7193376 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | [(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] 4-propan-2-yloxybenzoate |
| SMILES | CC(C)Oc1ccc(C(=O)O[C@H](C)C(=O)NC2CCCC2)cc1 |
| InChI | InChI=1S/C18H25NO4/c1-12(2)22-16-10-8-14(9-11-16)18(21)23-13(3)17(20)19-15-6-4-5-7-15/h8-13,15H,4-7H2,1-3H3,(H,19,20)/t13-/m1/s1 |
| InChIKey | UNBXKCKEEAMUMQ-CYBMUJFWSA-N |
| XLogP | 3.08 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |