C15H18FNO3 — CID 7478290
[(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] 4-fluorobenzoate (PubChem CID 7478290) has the molecular formula C15H18FNO3 and a molecular weight of 279.31 g/mol. Its IUPAC name is [(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] 4-fluorobenzoate.
| Compound Name | [(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 7478290 |
| Molecular Formula | C15H18FNO3 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | [(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] 4-fluorobenzoate |
| SMILES | C[C@@H](OC(=O)c1ccc(F)cc1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C15H18FNO3/c1-10(14(18)17-13-4-2-3-5-13)20-15(19)11-6-8-12(16)9-7-11/h6-10,13H,2-5H2,1H3,(H,17,18)/t10-/m1/s1 |
| InChIKey | QMAHQAQGXDNBRB-SNVBAGLBSA-N |
| XLogP | 2.43 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |