C16H20INO3 — CID 46790669
[1-(cyclohexylamino)-1-oxopropan-2-yl] 4-iodobenzoate (PubChem CID 46790669) has the molecular formula C16H20INO3 and a molecular weight of 401.24 g/mol. Its IUPAC name is [1-(cyclohexylamino)-1-oxopropan-2-yl] 4-iodobenzoate.
| Compound Name | [1-(cyclohexylamino)-1-oxopropan-2-yl] 4-iodobenzoate |
|---|---|
| PubChem CID | 46790669 |
| Molecular Formula | C16H20INO3 |
| Molecular Weight | 401.24 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | [1-(cyclohexylamino)-1-oxopropan-2-yl] 4-iodobenzoate |
| SMILES | CC(OC(=O)c1ccc(I)cc1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C16H20INO3/c1-11(15(19)18-14-5-3-2-4-6-14)21-16(20)12-7-9-13(17)10-8-12/h7-11,14H,2-6H2,1H3,(H,18,19) |
| InChIKey | KRKBFXRDZRWXMN-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.24 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|