C17H21F2NO5S — CID 18080217
[1-(cyclohexylamino)-1-oxopropan-2-yl] 4-(difluoromethylsulfonyl)benzoate (PubChem CID 18080217) has the molecular formula C17H21F2NO5S and a molecular weight of 389.42 g/mol. Its IUPAC name is [1-(cyclohexylamino)-1-oxopropan-2-yl] 4-(difluoromethylsulfonyl)benzoate.
| Compound Name | [1-(cyclohexylamino)-1-oxopropan-2-yl] 4-(difluoromethylsulfonyl)benzoate |
|---|---|
| PubChem CID | 18080217 |
| Molecular Formula | C17H21F2NO5S |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | [1-(cyclohexylamino)-1-oxopropan-2-yl] 4-(difluoromethylsulfonyl)benzoate |
| SMILES | CC(OC(=O)c1ccc(S(=O)(=O)C(F)F)cc1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C17H21F2NO5S/c1-11(15(21)20-13-5-3-2-4-6-13)25-16(22)12-7-9-14(10-8-12)26(23,24)17(18)19/h7-11,13,17H,2-6H2,1H3,(H,20,21) |
| InChIKey | MIKRTVXDEDKZRB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |