C18H24N2O5S — CID 7828392
[(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] 4-(prop-2-enylsulfamoyl)benzoate (PubChem CID 7828392) has the molecular formula C18H24N2O5S and a molecular weight of 380.47 g/mol. Its IUPAC name is [(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] 4-(prop-2-enylsulfamoyl)benzoate.
| Compound Name | [(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] 4-(prop-2-enylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 7828392 |
| Molecular Formula | C18H24N2O5S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | [(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] 4-(prop-2-enylsulfamoyl)benzoate |
| SMILES | C=CCNS(=O)(=O)c1ccc(C(=O)O[C@H](C)C(=O)NC2CCCC2)cc1 |
| InChI | InChI=1S/C18H24N2O5S/c1-3-12-19-26(23,24)16-10-8-14(9-11-16)18(22)25-13(2)17(21)20-15-6-4-5-7-15/h3,8-11,13,15,19H,1,4-7,12H2,2H3,(H,20,21)/t13-/m1/s1 |
| InChIKey | ADKBFVFGPWEXGQ-CYBMUJFWSA-N |
| XLogP | 1.75 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|