C18H25N3O6S — CID 8954828
[(2R)-1-(cyclopentylcarbamoylamino)-1-oxopropan-2-yl] 4-(ethylsulfamoyl)benzoate (PubChem CID 8954828) has the molecular formula C18H25N3O6S and a molecular weight of 411.48 g/mol. Its IUPAC name is [(2R)-1-(cyclopentylcarbamoylamino)-1-oxopropan-2-yl] 4-(ethylsulfamoyl)benzoate.
| Compound Name | [(2R)-1-(cyclopentylcarbamoylamino)-1-oxopropan-2-yl] 4-(ethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 8954828 |
| Molecular Formula | C18H25N3O6S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | [(2R)-1-(cyclopentylcarbamoylamino)-1-oxopropan-2-yl] 4-(ethylsulfamoyl)benzoate |
| SMILES | CCNS(=O)(=O)c1ccc(C(=O)O[C@H](C)C(=O)NC(=O)NC2CCCC2)cc1 |
| InChI | InChI=1S/C18H25N3O6S/c1-3-19-28(25,26)15-10-8-13(9-11-15)17(23)27-12(2)16(22)21-18(24)20-14-6-4-5-7-14/h8-12,14,19H,3-7H2,1-2H3,(H2,20,21,22,24)/t12-/m1/s1 |
| InChIKey | CXVBYVBHOUZDDQ-GFCCVEGCSA-N |
| XLogP | 1.30 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |