C21H30N2O5 — CID 7844796
[(2R)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 4-butoxybenzoate (PubChem CID 7844796) has the molecular formula C21H30N2O5 and a molecular weight of 390.48 g/mol. Its IUPAC name is [(2R)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 4-butoxybenzoate.
| Compound Name | [(2R)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 4-butoxybenzoate |
|---|---|
| PubChem CID | 7844796 |
| Molecular Formula | C21H30N2O5 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | [(2R)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 4-butoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)O[C@H](C)C(=O)NC(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C21H30N2O5/c1-3-4-14-27-18-12-10-16(11-13-18)20(25)28-15(2)19(24)23-21(26)22-17-8-6-5-7-9-17/h10-13,15,17H,3-9,14H2,1-2H3,(H2,22,23,24,26)/t15-/m1/s1 |
| InChIKey | NTGRVYGBPOZTNU-OAHLLOKOSA-N |
| XLogP | 3.57 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|