C17H24N2O5 — CID 2585392
[(2R)-1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 4-butoxybenzoate (PubChem CID 2585392) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is [(2R)-1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 4-butoxybenzoate.
| Compound Name | [(2R)-1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 4-butoxybenzoate |
|---|---|
| PubChem CID | 2585392 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | [(2R)-1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 4-butoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)O[C@H](C)C(=O)NC(=O)NCC)cc1 |
| InChI | InChI=1S/C17H24N2O5/c1-4-6-11-23-14-9-7-13(8-10-14)16(21)24-12(3)15(20)19-17(22)18-5-2/h7-10,12H,4-6,11H2,1-3H3,(H2,18,19,20,22)/t12-/m1/s1 |
| InChIKey | FDMPATUDEGKNBR-GFCCVEGCSA-N |
| XLogP | 2.26 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|