C14H16N2O5 — CID 40619590
[(2R)-1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 4-formylbenzoate (PubChem CID 40619590) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is [(2R)-1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 4-formylbenzoate.
| Compound Name | [(2R)-1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 4-formylbenzoate |
|---|---|
| PubChem CID | 40619590 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | [(2R)-1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 4-formylbenzoate |
| SMILES | CCNC(=O)NC(=O)[C@@H](C)OC(=O)c1ccc(C=O)cc1 |
| InChI | InChI=1S/C14H16N2O5/c1-3-15-14(20)16-12(18)9(2)21-13(19)11-6-4-10(8-17)5-7-11/h4-9H,3H2,1-2H3,(H2,15,16,18,20)/t9-/m1/s1 |
| InChIKey | WUVLVGJWVIYMKO-SECBINFHSA-N |
| XLogP | 0.89 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|