C17H25N3O6S — CID 2557534
[(2S)-1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 4-(diethylsulfamoyl)benzoate (PubChem CID 2557534) has the molecular formula C17H25N3O6S and a molecular weight of 399.47 g/mol. Its IUPAC name is [(2S)-1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 4-(diethylsulfamoyl)benzoate.
| Compound Name | [(2S)-1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 4-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2557534 |
| Molecular Formula | C17H25N3O6S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | [(2S)-1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 4-(diethylsulfamoyl)benzoate |
| SMILES | CCNC(=O)NC(=O)[C@H](C)OC(=O)c1ccc(S(=O)(=O)N(CC)CC)cc1 |
| InChI | InChI=1S/C17H25N3O6S/c1-5-18-17(23)19-15(21)12(4)26-16(22)13-8-10-14(11-9-13)27(24,25)20(6-2)7-3/h8-12H,5-7H2,1-4H3,(H2,18,19,21,23)/t12-/m0/s1 |
| InChIKey | NSFBTZWGUURLRZ-LBPRGKRZSA-N |
| XLogP | 1.11 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |